S-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate structure
|
Common Name | S-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate | ||
|---|---|---|---|---|
| CAS Number | 74875-15-3 | Molecular Weight | 295.14200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8Cl2N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-(2,6-dichloro-4-nitrophenyl) N,N-dimethylcarbamothioate |
|---|
| Molecular Formula | C9H8Cl2N2O3S |
|---|---|
| Molecular Weight | 295.14200 |
| Exact Mass | 293.96300 |
| PSA | 91.43000 |
| LogP | 4.19850 |
| InChIKey | QWOGNQCPUPCVSE-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Sc1c(Cl)cc([N+](=O)[O-])cc1Cl |
|
~%
S-(2,6-dichloro... CAS#:74875-15-3 |
| Literature: Miller; Mylari; Howes Jr.; Figdor; Lynch; Koch Journal of Medicinal Chemistry, 1980 , vol. 23, # 10 p. 1083 - 1087 |
|
~%
S-(2,6-dichloro... CAS#:74875-15-3 |
| Literature: Miller; Mylari; Howes Jr.; Figdor; Lynch; Koch Journal of Medicinal Chemistry, 1980 , vol. 23, # 10 p. 1083 - 1087 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |