1-[tert-butyl(dimethyl)silyl]-4-prop-2-enylazetidin-2-one structure
|
Common Name | 1-[tert-butyl(dimethyl)silyl]-4-prop-2-enylazetidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 74819-64-0 | Molecular Weight | 225.40300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H23NOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[tert-butyl(dimethyl)silyl]-4-prop-2-enylazetidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H23NOSi |
|---|---|
| Molecular Weight | 225.40300 |
| Exact Mass | 225.15500 |
| PSA | 20.31000 |
| LogP | 3.10650 |
| InChIKey | DDKTYODBHATVFB-UHFFFAOYSA-N |
| SMILES | C=CCC1CC(=O)N1[Si](C)(C)C(C)(C)C |
|
~94%
1-[tert-butyl(d... CAS#:74819-64-0 |
| Literature: Crombie, Leslie; Haigh, David; Jones, Raymond C. F.; Mat-Zin, Ab. Rasid Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1993 , # 17 p. 2055 - 2068 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-allyl-1-dimethyl-t-butylsilylazetidin-2-one |
| 4-Allyl-1-dimethyl-tert-butylsilylazetidin-2-one |