Propanedioic acid,2-(3,4,5-trimethoxybenzoyl)-, 1,3-diethyl ester structure
|
Common Name | Propanedioic acid,2-(3,4,5-trimethoxybenzoyl)-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7478-67-3 | Molecular Weight | 354.35200 | |
| Density | 1.183g/cm3 | Boiling Point | 426.9ºC at 760 mmHg | |
| Molecular Formula | C17H22O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185ºC | |
| Name | diethyl 2-(3,4,5-trimethoxybenzoyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 426.9ºC at 760 mmHg |
| Molecular Formula | C17H22O8 |
| Molecular Weight | 354.35200 |
| Flash Point | 185ºC |
| Exact Mass | 354.13100 |
| PSA | 97.36000 |
| LogP | 1.63750 |
| Index of Refraction | 1.497 |
| InChIKey | FJBSMQDCNWGUEC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)C(=O)c1cc(OC)c(OC)c(OC)c1 |
| HS Code | 2918990090 |
|---|
|
~%
Propanedioic ac... CAS#:7478-67-3 |
| Literature: Huang; Tarbell; Arnstein Journal of the American Chemical Society, 1948 , vol. 70, p. 4181,4183 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| diethyl(3,4,5-trimethoxybenzoyl)malonate |
| T0514-7064 |
| (3,4,5-Trimethoxy-benzoyl)-malonsaeure-diaethylester |
| (3,4,5-trimethoxy-benzoyl)-malonic acid diethyl ester |