N-(2-methoxyphenyl)-1-[2-[N-(2-methoxyphenyl)carbamimidoyl]sulfanylethylsulfanyl]methanimidamide
Modify Date: 2025-12-08 20:02:35
![N-(2-methoxyphenyl)-1-[2-[N-(2-methoxyphenyl)carbamimidoyl]sulfanylethylsulfanyl]methanimidamide Structure](https://image.chemsrc.com/caspic/404/7478-44-6.png)
N-(2-methoxyphenyl)-1-[2-[N-(2-methoxyphenyl)carbamimidoyl]sulfanylethylsulfanyl]methanimidamide structure
|
Common Name | N-(2-methoxyphenyl)-1-[2-[N-(2-methoxyphenyl)carbamimidoyl]sulfanylethylsulfanyl]methanimidamide | ||
|---|---|---|---|---|
| CAS Number | 7478-44-6 | Molecular Weight | 471.43500 | |
| Density | 1.26g/cm3 | Boiling Point | 619.8ºC at 760 mmHg | |
| Molecular Formula | C18H23BrN4O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.6ºC | |
| Name | 2-[N'-(2-methoxyphenyl)carbamimidoyl]sulfanylethyl N'-(2-methoxyphenyl)carbamimidothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 619.8ºC at 760 mmHg |
| Molecular Formula | C18H23BrN4O2S2 |
| Molecular Weight | 471.43500 |
| Flash Point | 328.6ºC |
| Exact Mass | 470.04500 |
| PSA | 140.82000 |
| LogP | 5.86730 |
| Index of Refraction | 1.619 |
| InChIKey | OTNSKBPJIBCAMQ-UHFFFAOYSA-N |
| SMILES | Br.COc1ccccc1N=C(N)SCCSC(N)=Nc1ccccc1OC |
|
~%
N-(2-methoxyphe... CAS#:7478-44-6 |
| Literature: Grogan et al. Journal of Organic Chemistry, 1953 , vol. 18, p. 728,731,733 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(2-METHOXYPHENYL)-1-[2-[N-(2-METHOXYPHENYL)CARBAMIMIDOYL]SULFANYLETHYLSULFANYL]METHANIMIDAMIDE |
| N,N''-Bis-(2-methoxy-phenyl)-S,S'-aethandiyl-bis-isothioharnstoff,Dihydrobromid |
| N,N''-bis-(2-methoxy-phenyl)-S,S'-ethanediyl-bis-isothiourea,dihydrobromide |