4-[(benzylamino)-ethoxy-phosphoryl]aniline
Modify Date: 2025-09-12 19:06:33
![4-[(benzylamino)-ethoxy-phosphoryl]aniline Structure](https://image.chemsrc.com/caspic/005/7477-55-6.png)
4-[(benzylamino)-ethoxy-phosphoryl]aniline structure
|
Common Name | 4-[(benzylamino)-ethoxy-phosphoryl]aniline | ||
|---|---|---|---|---|
| CAS Number | 7477-55-6 | Molecular Weight | 290.29700 | |
| Density | 1.19g/cm3 | Boiling Point | 447.5ºC at 760 mmHg | |
| Molecular Formula | C15H19N2O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.4ºC | |
| Name | 4-[(benzylamino)-ethoxyphosphoryl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 447.5ºC at 760 mmHg |
| Molecular Formula | C15H19N2O2P |
| Molecular Weight | 290.29700 |
| Flash Point | 224.4ºC |
| Exact Mass | 290.11800 |
| PSA | 74.16000 |
| LogP | 3.88560 |
| Index of Refraction | 1.583 |
| InChIKey | UIROPQODOBXNNG-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(NCc1ccccc1)c1ccc(N)cc1 |
|
~%
4-[(benzylamino... CAS#:7477-55-6 |
| Literature: Burger; Anderson Journal of the American Chemical Society, 1957 , vol. 79, p. 3575,3577 |
|
~%
4-[(benzylamino... CAS#:7477-55-6 |
| Literature: Burger; Anderson Journal of the American Chemical Society, 1957 , vol. 79, p. 3575,3577 |
|
~%
4-[(benzylamino... CAS#:7477-55-6 |
| Literature: Burger; Anderson Journal of the American Chemical Society, 1957 , vol. 79, p. 3575,3577 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (4-Amino-phenyl)-phosphonsaeure-aethylester-benzylamid |
| (4-amino-phenyl)-phosphonic acid ethyl ester-benzylamide |