ethyl 4-hydroxyimino-1-phenyl-cyclohexane-1-carboxylate
Modify Date: 2025-09-17 19:38:55
ethyl 4-hydroxyimino-1-phenyl-cyclohexane-1-carboxylate structure
|
Common Name | ethyl 4-hydroxyimino-1-phenyl-cyclohexane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 7475-62-9 | Molecular Weight | 261.31600 | |
| Density | 1.14g/cm3 | Boiling Point | 401.6ºC at 760 mmHg | |
| Molecular Formula | C15H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.7ºC | |
| Name | ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 401.6ºC at 760 mmHg |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.31600 |
| Flash Point | 196.7ºC |
| Exact Mass | 261.13600 |
| PSA | 58.89000 |
| LogP | 2.89170 |
| Index of Refraction | 1.555 |
| InChIKey | JSGNAEIYJHTTFR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(c2ccccc2)CCC(=NO)CC1 |
|
~%
ethyl 4-hydroxy... CAS#:7475-62-9 |
| Literature: Rubin; Wishinsky Journal of the American Chemical Society, 1946 , vol. 68, p. 828,831 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Hydroxyimino-1-phenyl-cyclohexancarbonsaeure-aethylester |
| ETHYL 4-HYDROXYIMINO-1-PHENYL-CYCLOHEXANE-1-CARBOXYLATE |
| 4-hydroxyimino-1-phenyl-cyclohexanecarboxylic acid ethyl ester |