1H-Azepine-4-carboxylic acid, hexahydro-1-methyl-4-phenyl-
Modify Date: 2025-12-01 15:43:12
1H-Azepine-4-carboxylic acid, hexahydro-1-methyl-4-phenyl- structure
|
Common Name | 1H-Azepine-4-carboxylic acid, hexahydro-1-methyl-4-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 7475-57-2 | Molecular Weight | 233.30600 | |
| Density | 1.11g/cm3 | Boiling Point | 376.2ºC at 760 mmHg | |
| Molecular Formula | C14H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.3ºC | |
| Name | 1-methyl-4-phenylazepane-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 376.2ºC at 760 mmHg |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.30600 |
| Flash Point | 181.3ºC |
| Exact Mass | 233.14200 |
| PSA | 40.54000 |
| LogP | 2.06260 |
| Index of Refraction | 1.544 |
| InChIKey | RJTBKADDKPPZOZ-UHFFFAOYSA-N |
| SMILES | CN1CCCC(C(=O)O)(c2ccccc2)CC1 |
|
~%
1H-Azepine-4-ca... CAS#:7475-57-2 |
| Literature: Diamond et al. Journal of Organic Chemistry, 1957 , vol. 22, p. 399,404 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-methyl-4-phenyl-hexahydro-azepine-4-carboxylic acid |
| 1-Methyl-4-phenyl-hexahydro-azepin-4-carbonsaeure |
| 1H-Azepine-4-carboxylic acid,hexahydro-1-methyl-4-phenyl |
| Hexahydro-1-methyl-4-phenyl-1H-azepine-4-carboxylic acid |