5H-Benzocycloheptene-8,9-diaceticacid, 6,7-dihydro-
Modify Date: 2025-09-25 19:24:15
5H-Benzocycloheptene-8,9-diaceticacid, 6,7-dihydro- structure
|
Common Name | 5H-Benzocycloheptene-8,9-diaceticacid, 6,7-dihydro- | ||
|---|---|---|---|---|
| CAS Number | 7475-49-2 | Molecular Weight | 260.28500 | |
| Density | 1.253g/cm3 | Boiling Point | 500ºC at 760mmHg | |
| Molecular Formula | C15H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.3ºC | |
| Name | 2-[5-(carboxymethyl)-8,9-dihydro-7H-benzo[7]annulen-6-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 500ºC at 760mmHg |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.28500 |
| Flash Point | 270.3ºC |
| Exact Mass | 260.10500 |
| PSA | 74.60000 |
| LogP | 2.72590 |
| Index of Refraction | 1.579 |
| InChIKey | DSBCSPRQHLEMRA-UHFFFAOYSA-N |
| SMILES | O=C(O)CC1=C(CC(=O)O)c2ccccc2CCC1 |
|
~%
5H-Benzocyclohe... CAS#:7475-49-2 |
| Literature: Horton et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 4587 |
![methyl 2-(2-oxo-3a,4,5,6-tetrahydro-3H-benzo[1,2]cyclohepta[4,6-c]furan-10b-yl)acetate structure](https://image.chemsrc.com/caspic/066/7478-62-8.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5H-Benzocycloheptene-8,9-diaceticacid,6,7-dihydro |