2-(4-chlorophenyl)anthracene-9,10-dione structure
|
Common Name | 2-(4-chlorophenyl)anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 7475-46-9 | Molecular Weight | 318.75300 | |
| Density | 1.348g/cm3 | Boiling Point | 528.1ºC at 760 mmHg | |
| Molecular Formula | C20H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.2ºC | |
| Name | 2-(4-chlorophenyl)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 528.1ºC at 760 mmHg |
| Molecular Formula | C20H11ClO2 |
| Molecular Weight | 318.75300 |
| Flash Point | 220.2ºC |
| Exact Mass | 318.04500 |
| PSA | 34.14000 |
| LogP | 4.78240 |
| Index of Refraction | 1.668 |
| InChIKey | XMZWGZOUBDJOEI-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2cc(-c3ccc(Cl)cc3)ccc21 |
|
~%
2-(4-chlorophen... CAS#:7475-46-9 |
| Literature: Groggins Industrial and Engineering Chemistry, 1930 , vol. 22, p. 620,622 |
| 2-(4-Chlor-phenyl)-anthrachinon |
| 2-(4-chloro-phenyl)-anthraquinone |
| 2-(p-Chlorphenyl)anthrachinon |