3-(6-hydroxy-7-methoxy-benzofuran-5-yl)prop-2-enehydrazide structure
|
Common Name | 3-(6-hydroxy-7-methoxy-benzofuran-5-yl)prop-2-enehydrazide | ||
|---|---|---|---|---|
| CAS Number | 7474-72-8 | Molecular Weight | 248.23500 | |
| Density | 1.383g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-3-(6-hydroxy-7-methoxy-1-benzofuran-5-yl)prop-2-enehydrazide |
|---|
| Density | 1.383g/cm3 |
|---|---|
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.23500 |
| Exact Mass | 248.08000 |
| PSA | 97.72000 |
| LogP | 2.24130 |
| Index of Refraction | 1.682 |
| InChIKey | PHEXJXQYHJMKPA-NSCUHMNNSA-N |
| SMILES | COc1c(O)c(C=CC(=O)NN)cc2ccoc12 |
|
~%
3-(6-hydroxy-7-... CAS#:7474-72-8 |
| Literature: Brokke; Christensen Journal of Organic Chemistry, 1958 , vol. 23, p. 589,594 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |