5,7-dimethoxy-3,4-bis(4-methoxyphenyl)-2H-chromene structure
|
Common Name | 5,7-dimethoxy-3,4-bis(4-methoxyphenyl)-2H-chromene | ||
|---|---|---|---|---|
| CAS Number | 7473-32-7 | Molecular Weight | 404.45500 | |
| Density | 1.186g/cm3 | Boiling Point | 554.3ºC at 760 mmHg | |
| Molecular Formula | C25H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.9ºC | |
| Name | 5,7-dimethoxy-3,4-bis(4-methoxyphenyl)-2H-chromene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 554.3ºC at 760 mmHg |
| Molecular Formula | C25H24O5 |
| Molecular Weight | 404.45500 |
| Flash Point | 223.9ºC |
| Exact Mass | 404.16200 |
| PSA | 46.15000 |
| LogP | 5.07250 |
| Index of Refraction | 1.591 |
| InChIKey | COIHZMKRBHUILH-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2=C(c3ccc(OC)cc3)c3c(OC)cc(OC)cc3OC2)cc1 |
|
~%
5,7-dimethoxy-3... CAS#:7473-32-7 |
| Literature: Bradbury Australian Journal of Chemistry, 1953 , vol. 6, p. 447 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5,7-dimethoxy-3,4-bis-(4-methoxy-phenyl)-2H-chromene |