piperafizine B
Modify Date: 2025-10-01 14:26:54
piperafizine B structure
|
Common Name | piperafizine B | ||
|---|---|---|---|---|
| CAS Number | 74720-33-5 | Molecular Weight | 290.31600 | |
| Density | 1.278g/cm3 | Boiling Point | 646.2ºC at 760 mmHg | |
| Molecular Formula | C18H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.2ºC | |
| Name | (3Z,6Z)-3,6-dibenzylidenepiperazine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278g/cm3 |
|---|---|
| Boiling Point | 646.2ºC at 760 mmHg |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.31600 |
| Flash Point | 258.2ºC |
| Exact Mass | 290.10600 |
| PSA | 66.24000 |
| LogP | 1.54540 |
| Index of Refraction | 1.688 |
| InChIKey | RFSUEJIDSYCCLL-NFLUSIDLSA-N |
| SMILES | O=c1[nH]c(=Cc2ccccc2)c(=O)[nH]c1=Cc1ccccc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,6-dibenzylidenepiperazine-2,5-dione |
| Piperafizine B |
| 3,6-Dibenzyliden-piperazin-2,5-dion |
| 3,6-dibenzylidene-2,5-piperazinedione |
| 3,6-Dibenzylidene-2,5-dioxopiperazine |