2,4,6(1H,3H,5H)-Pyrimidinetrione,5-hydroxy-5-[(phenylmethyl)thio]- structure
|
Common Name | 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-hydroxy-5-[(phenylmethyl)thio]- | ||
|---|---|---|---|---|
| CAS Number | 7472-19-7 | Molecular Weight | 266.27300 | |
| Density | 1.54g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-benzylsulfanyl-5-hydroxy-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Molecular Formula | C11H10N2O4S |
| Molecular Weight | 266.27300 |
| Exact Mass | 266.03600 |
| PSA | 120.80000 |
| LogP | 0.63200 |
| Index of Refraction | 1.68 |
| InChIKey | HDQHCIADWIJQMX-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(O)(SCc2ccccc2)C(=O)N1 |
|
~%
2,4,6(1H,3H,5H)... CAS#:7472-19-7 |
| Literature: d'Ouville et al. Journal of the American Chemical Society, 1939 , vol. 61, p. 2033,2035 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-benzylmercapto-5-hydroxy-barbituric acid |
| 5-Benzylmercapto-5-hydroxy-barbitursaeure |