(2',2'-dimethyl-5'-oxospiro[fluorene-9,4'-oxolane]-3'-yl) 4-nitrobenzoate structure
|
Common Name | (2',2'-dimethyl-5'-oxospiro[fluorene-9,4'-oxolane]-3'-yl) 4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 7471-92-3 | Molecular Weight | 429.42100 | |
| Density | 1.41g/cm3 | Boiling Point | 655ºC at 760 mmHg | |
| Molecular Formula | C25H19NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.6ºC | |
| Name | (2',2'-dimethyl-5'-oxospiro[fluorene-9,4'-oxolane]-3'-yl) 4-nitrobenzoate |
|---|
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 655ºC at 760 mmHg |
| Molecular Formula | C25H19NO6 |
| Molecular Weight | 429.42100 |
| Flash Point | 266.6ºC |
| Exact Mass | 429.12100 |
| PSA | 98.42000 |
| LogP | 4.94550 |
| Index of Refraction | 1.675 |
| InChIKey | YJYUAVSEWQEWPP-UHFFFAOYSA-N |
| SMILES | CC1(C)OC(=O)C2(c3ccccc3-c3ccccc32)C1OC(=O)c1ccc([N+](=O)[O-])cc1 |
|
~%
(2',2'-dimethyl... CAS#:7471-92-3 |
| Literature: Stevens; Winch Journal of the American Chemical Society, 1959 , vol. 81, p. 1172,1175 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |