[1,4-diacetyloxy-6-bromo-3-(2-phenylethenyl)naphthalen-2-yl] acetate structure
|
Common Name | [1,4-diacetyloxy-6-bromo-3-(2-phenylethenyl)naphthalen-2-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 7471-45-6 | Molecular Weight | 483.30800 | |
| Density | 1.439g/cm3 | Boiling Point | 615.1ºC at 760 mmHg | |
| Molecular Formula | C24H19BrO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325.8ºC | |
| Name | [2,4-diacetyloxy-6-bromo-3-[(E)-2-phenylethenyl]naphthalen-1-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.439g/cm3 |
|---|---|
| Boiling Point | 615.1ºC at 760 mmHg |
| Molecular Formula | C24H19BrO6 |
| Molecular Weight | 483.30800 |
| Flash Point | 325.8ºC |
| Exact Mass | 482.03700 |
| PSA | 78.90000 |
| LogP | 5.54860 |
| Index of Refraction | 1.654 |
| InChIKey | ZTCYOANWJZMHPA-PKNBQFBNSA-N |
| SMILES | CC(=O)Oc1c(C=Cc2ccccc2)c(OC(C)=O)c2cc(Br)ccc2c1OC(C)=O |
|
~%
[1,4-diacetylox... CAS#:7471-45-6 |
| Literature: Fieser; Hartwell; Seligman Journal of the American Chemical Society, 1936 , vol. 58, p. 1223,1227 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,2,4-Triacetoxy-6-brom-3-styryl-naphthalin |
| 1,2,4-triacetoxy-6-bromo-3-styryl-naphthalene |