(4-nitrophenyl)methyl 2-nitrobenzoate structure
|
Common Name | (4-nitrophenyl)methyl 2-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 7471-30-9 | Molecular Weight | 302.23900 | |
| Density | 1.427g/cm3 | Boiling Point | 478.6ºC at 760 mmHg | |
| Molecular Formula | C14H10N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.6ºC | |
| Name | (4-nitrophenyl)methyl 2-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.427g/cm3 |
|---|---|
| Boiling Point | 478.6ºC at 760 mmHg |
| Molecular Formula | C14H10N2O6 |
| Molecular Weight | 302.23900 |
| Flash Point | 214.6ºC |
| Exact Mass | 302.05400 |
| PSA | 117.94000 |
| LogP | 3.90640 |
| Index of Refraction | 1.632 |
| InChIKey | KJUUWRYIMNTSLH-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)c1ccccc1[N+](=O)[O-] |
|
~%
(4-nitrophenyl)... CAS#:7471-30-9 |
| Literature: Reid Journal of the American Chemical Society, 1917 , vol. 39, p. 132 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Nitro-benzoesaeure-(4-nitro-benzylester) |
| 4-nitrobenzyl 2-nitrobenzoate |
| 2-nitro-benzoic acid-(4-nitro-benzyl ester) |