1-(3-methoxyphenanthren-9-yl)-2-morpholin-4-yl-ethanone structure
|
Common Name | 1-(3-methoxyphenanthren-9-yl)-2-morpholin-4-yl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 7470-65-7 | Molecular Weight | 371.85700 | |
| Density | 1.207g/cm3 | Boiling Point | 542.9ºC at 760 mmHg | |
| Molecular Formula | C21H22ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.1ºC | |
| Name | 1-(3-methoxyphenanthren-9-yl)-2-morpholin-4-ylethanone,hydrochloride |
|---|
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 542.9ºC at 760 mmHg |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.85700 |
| Flash Point | 282.1ºC |
| Exact Mass | 371.12900 |
| PSA | 38.77000 |
| LogP | 4.25640 |
| Index of Refraction | 1.641 |
| InChIKey | OZFUZXMVZFPBCM-UHFFFAOYSA-N |
| SMILES | COc1ccc2cc(C(=O)CN3CCOCC3)c3ccccc3c2c1.Cl |
|
~%
1-(3-methoxyphe... CAS#:7470-65-7 |
| Literature: Mosettig et al. Journal of the American Chemical Society, 1938 , vol. 60, p. 2464 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |