2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(2-cyclopentylethyl)-5-(2-phenylethyl)- structure
|
Common Name | 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(2-cyclopentylethyl)-5-(2-phenylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 7468-40-8 | Molecular Weight | 328.40500 | |
| Density | 1.144g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2-cyclopentylethyl)-5-(2-phenylethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.144g/cm3 |
|---|---|
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.40500 |
| Exact Mass | 328.17900 |
| PSA | 75.27000 |
| LogP | 3.59960 |
| Index of Refraction | 1.537 |
| InChIKey | KREKKVFMTNLVQL-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(CCc2ccccc2)(CCC2CCCC2)C(=O)N1 |
|
~%
2,4,6(1H,3H,5H)... CAS#:7468-40-8 |
| Literature: Blicke; Zienty Journal of the American Chemical Society, 1941 , vol. 63, p. 2991 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-(2-Cyclopentyl-aethyl)-5-phenaethyl-barbitursaeure |
| 5-(2-cyclopentylethyl)-5-phenethyl-1,3-diazinane-2,4,6-trione |
| 5-(2-cyclopentylethyl)-5-(2-phenylethyl)pyrimidine-2,4,6(1H,3H,5H)-trione |
| 5-(2-cyclopentyl-ethyl)-5-phenethyl-barbituric acid |