3-Pentanol,2,2,4,4-tetramethyl-, 3-(N-phenylcarbamate) structure
|
Common Name | 3-Pentanol,2,2,4,4-tetramethyl-, 3-(N-phenylcarbamate) | ||
|---|---|---|---|---|
| CAS Number | 7467-81-4 | Molecular Weight | 263.37500 | |
| Density | 1.007g/cm3 | Boiling Point | 311ºC at 760mmHg | |
| Molecular Formula | C16H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.9ºC | |
| Name | 2,2,4,4-tetramethylpentan-3-yl N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.007g/cm3 |
|---|---|
| Boiling Point | 311ºC at 760mmHg |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.37500 |
| Flash Point | 141.9ºC |
| Exact Mass | 263.18900 |
| PSA | 38.33000 |
| LogP | 4.76890 |
| Index of Refraction | 1.518 |
| InChIKey | ZXJFUPSUJNJUOV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(OC(=O)Nc1ccccc1)C(C)(C)C |
|
~%
3-Pentanol,2,2,... CAS#:7467-81-4 |
| Literature: Greenwood; Whitmore; Crooks Journal of the American Chemical Society, 1938 , vol. 60, p. 2028 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Phenyl-carbamidsaeure-(1-tert-butyl-2,2-dimethyl-propylester) |
| 2,2,4,4-Tetramethyl-pentanol-(3)-phenylurethan |
| phenyl-carbamic acid-(1-tert-butyl-2,2-dimethyl-propyl ester) |
| 3-Phenylcarbamoyloxy-2.2.4.4-tetramethyl-pentan |