3-Methylene-1,2-cyclopentanedicarboxylic acid dimethyl ester
Modify Date: 2025-09-26 12:30:11
3-Methylene-1,2-cyclopentanedicarboxylic acid dimethyl ester structure
|
Common Name | 3-Methylene-1,2-cyclopentanedicarboxylic acid dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 74663-84-6 | Molecular Weight | 198.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | cis-2,3-Dicarbomethoxy-methylencyclopentan |
|---|
| Molecular Formula | C10H14O4 |
|---|---|
| Molecular Weight | 198.21600 |
| Exact Mass | 198.08900 |
| PSA | 52.60000 |
| LogP | 0.91480 |
| InChIKey | JOTPIAUJQBECPZ-UHFFFAOYSA-N |
| SMILES | C=C1CCC(C(=O)OC)C1C(=O)OC |
| HS Code | 2917209090 |
|---|
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |