3-(4-methoxyphenyl)iminoisobenzofuran-1-one
Modify Date: 2025-10-24 18:49:31
3-(4-methoxyphenyl)iminoisobenzofuran-1-one structure
|
Common Name | 3-(4-methoxyphenyl)iminoisobenzofuran-1-one | ||
|---|---|---|---|---|
| CAS Number | 7466-55-9 | Molecular Weight | 253.25300 | |
| Density | 1.24g/cm3 | Boiling Point | 421.6ºC at 760 mmHg | |
| Molecular Formula | C15H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.9ºC | |
| Name | 3-(4-methoxyphenyl)imino-2-benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 421.6ºC at 760 mmHg |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.25300 |
| Flash Point | 201.9ºC |
| Exact Mass | 253.07400 |
| PSA | 47.89000 |
| LogP | 2.94390 |
| Index of Refraction | 1.612 |
| InChIKey | VAYDKYQRXSBABZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=C2OC(=O)c3ccccc32)cc1 |
|
~86%
3-(4-methoxyphe... CAS#:7466-55-9 |
| Literature: Guirado, Antonio; Zapata, Andres; Fenor, Manuel Tetrahedron Letters, 1991 , vol. 32, # 23 p. 2633 - 2636 |
|
~63%
3-(4-methoxyphe... CAS#:7466-55-9 |
| Literature: Perry, Christopher J.; Parveen, Zahida Journal of the Chemical Society. Perkin Transactions 2, 2001 , # 4 p. 512 - 521 |
CAS#:2142-04-3| 3-(4-methoxy-phenylimino)-3H-isobenzofuran-1-one |
| N-(4-Methoxy-phenyl)-phthalisoimid |
| 3-[(4-methoxyphenyl)imino]-1(3H)-isobenzofuran-1-one |