3-methyl-2-(4-methylphenyl)sulfonyloxy-4,6,9,11-tetraoxabicyclo[5.4.0]undecane structure
|
Common Name | 3-methyl-2-(4-methylphenyl)sulfonyloxy-4,6,9,11-tetraoxabicyclo[5.4.0]undecane | ||
|---|---|---|---|---|
| CAS Number | 7465-83-0 | Molecular Weight | 344.38000 | |
| Density | 1.36g/cm3 | Boiling Point | 486.9ºC at 760 mmHg | |
| Molecular Formula | C15H20O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.2ºC | |
| Name | (8-methyl-4a,8,9,9a-tetrahydro-4H-[1,3]dioxino[5,4-d][1,3]dioxepin-9-yl) 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 486.9ºC at 760 mmHg |
| Molecular Formula | C15H20O7S |
| Molecular Weight | 344.38000 |
| Flash Point | 248.2ºC |
| Exact Mass | 344.09300 |
| PSA | 88.67000 |
| LogP | 2.28400 |
| Index of Refraction | 1.561 |
| InChIKey | QUTYBMLORNZFAB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OC2C(C)OCOC3COCOC32)cc1 |
|
~%
3-methyl-2-(4-m... CAS#:7465-83-0 |
| Literature: Haskins et al. Journal of the American Chemical Society, 1945 , vol. 67, p. 1800,1805 |
|
~%
3-methyl-2-(4-m... CAS#:7465-83-0 |
| Literature: Haskins et al. Journal of the American Chemical Society, 1945 , vol. 67, p. 1800,1805 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Tosyl-1,3 |
| Toluene-4-sulfonic acid 8-methyl-tetrahydro-1,3,5,7-tetraoxa-benzocyclohepten-9-yl ester |
| 1,3:2,5-Di-O-methylen-4-O-p-tolylsulfonyl-L-rhamnitol |
| 2,5-dimethylene-l-rhamnitol |