Benzeneacetic acid, a-(1-cyclopropyl-1-hydroxyethyl)- structure
|
Common Name | Benzeneacetic acid, a-(1-cyclopropyl-1-hydroxyethyl)- | ||
|---|---|---|---|---|
| CAS Number | 7465-24-9 | Molecular Weight | 220.26400 | |
| Density | 1.272g/cm3 | Boiling Point | 372.2ºC at 760 mmHg | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.1ºC | |
| Name | 3-cyclopropyl-3-hydroxy-2-phenylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 372.2ºC at 760 mmHg |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26400 |
| Flash Point | 193.1ºC |
| Exact Mass | 220.11000 |
| PSA | 57.53000 |
| LogP | 2.01580 |
| Index of Refraction | 1.605 |
| InChIKey | SLDAEGGTLLAFPL-UHFFFAOYSA-N |
| SMILES | CC(O)(C1CC1)C(C(=O)O)c1ccccc1 |
|
~%
Benzeneacetic a... CAS#:7465-24-9 |
| Literature: Blicke; Zinnes Journal of the American Chemical Society, 1955 , vol. 77, p. 6247 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-cyclopropyl-3-hydroxy-2-phenyl-butyric acid |
| 3-Cyclopropyl-3-hydroxy-2-phenyl-buttersaeure |