9-propan-2-yl-3H-purine-2,6-dione structure
|
Common Name | 9-propan-2-yl-3H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 7464-92-8 | Molecular Weight | 194.19100 | |
| Density | 1.59g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-propan-2-yl-3H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19100 |
| Exact Mass | 194.08000 |
| PSA | 83.54000 |
| Index of Refraction | 1.73 |
| InChIKey | NRUPICKXZJJQKQ-UHFFFAOYSA-N |
| SMILES | CC(C)n1cnc2c(=O)[nH]c(=O)[nH]c21 |
|
~%
9-propan-2-yl-3... CAS#:7464-92-8 |
| Literature: Blicke; Schaaf Journal of the American Chemical Society, 1956 , vol. 78, p. 5857,5860 |
|
~%
9-propan-2-yl-3... CAS#:7464-92-8 |
| Literature: Blicke; Schaaf Journal of the American Chemical Society, 1956 , vol. 78, p. 5857,5860 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 9-Isopropyl-3,9-dihydro-purin-2,6-dion |
| 9-isopropyl-3,9-dihydro-purine-2,6-dione |