1-Bromo-4-(2-methylphenoxy)sulfonyl-benzene structure
|
Common Name | 1-Bromo-4-(2-methylphenoxy)sulfonyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 7463-25-4 | Molecular Weight | 327.19400 | |
| Density | 1.517g/cm3 | Boiling Point | 429ºC at 760 mmHg | |
| Molecular Formula | C13H11BrO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.2ºC | |
| Name | (2-methylphenyl) 4-bromobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.517g/cm3 |
|---|---|
| Boiling Point | 429ºC at 760 mmHg |
| Molecular Formula | C13H11BrO3S |
| Molecular Weight | 327.19400 |
| Flash Point | 213.2ºC |
| Exact Mass | 325.96100 |
| PSA | 51.75000 |
| LogP | 4.60600 |
| Index of Refraction | 1.606 |
| InChIKey | CWXXRMDWLWLJPB-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1OS(=O)(=O)c1ccc(Br)cc1 |
|
~%
1-Bromo-4-(2-me... CAS#:7463-25-4 |
| Literature: Sekera Journal of the American Chemical Society, 1933 , vol. 55, p. 421 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-bromo-benzenesulfonic acid o-tolyl ester |
| 4-Brom-benzolsulfonsaeure-o-tolylester |