1,3,3-trimethylbicyclo[2.2.1]hept-2-yl salicylate structure
|
Common Name | 1,3,3-trimethylbicyclo[2.2.1]hept-2-yl salicylate | ||
|---|---|---|---|---|
| CAS Number | 7462-24-0 | Molecular Weight | 274.35500 | |
| Density | 1.16g/cm3 | Boiling Point | 350.3ºC at 760 mmHg | |
| Molecular Formula | C17H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.5ºC | |
| Name | (2,2,4-trimethyl-3-bicyclo[2.2.1]heptanyl) 2-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 350.3ºC at 760 mmHg |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.35500 |
| Flash Point | 136.5ºC |
| Exact Mass | 274.15700 |
| PSA | 46.53000 |
| LogP | 3.76380 |
| Index of Refraction | 1.568 |
| InChIKey | XQPZKMWBRDTOGK-UHFFFAOYSA-N |
| SMILES | CC12CCC(C1)C(C)(C)C2OC(=O)c1ccccc1O |
| HS Code | 2918230000 |
|---|
|
~%
1,3,3-trimethyl... CAS#:7462-24-0 |
| Literature: Chem. Fabr. v. Kereszty, Wolf and Co. Patent: DE253756 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 905 |
|
~%
1,3,3-trimethyl... CAS#:7462-24-0 |
| Literature: Chem. Fabr. v. Kereszty, Wolf and Co. Patent: DE253756 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 905 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918230000 |
|---|---|
| Summary | 2918230000 other esters of salicylic acid and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Salicylsaeurefenchylester |
| FENCHYL SALICYLATE |