ethyl 2-(2,4-dichlorophenoxy)heptanoate
Modify Date: 2025-08-25 13:15:22
ethyl 2-(2,4-dichlorophenoxy)heptanoate structure
|
Common Name | ethyl 2-(2,4-dichlorophenoxy)heptanoate | ||
|---|---|---|---|---|
| CAS Number | 7462-16-0 | Molecular Weight | 319.22400 | |
| Density | 1.168g/cm3 | Boiling Point | 382.6ºC at 760 mmHg | |
| Molecular Formula | C15H20Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.3ºC | |
| Name | ethyl 2-(2,4-dichlorophenoxy)heptanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 382.6ºC at 760 mmHg |
| Molecular Formula | C15H20Cl2O3 |
| Molecular Weight | 319.22400 |
| Flash Point | 135.3ºC |
| Exact Mass | 318.07900 |
| PSA | 35.53000 |
| LogP | 4.88420 |
| Index of Refraction | 1.508 |
| InChIKey | TXXLNSFJTZKNCK-UHFFFAOYSA-N |
| SMILES | CCCCCC(Oc1ccc(Cl)cc1Cl)C(=O)OCC |
|
~%
ethyl 2-(2,4-di... CAS#:7462-16-0 |
| Literature: Newman; Fones; Renoll Journal of the American Chemical Society, 1947 , vol. 69, p. 718,721 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-(2,4-dichloro-phenoxy)-heptanoic acid ethyl ester |
| 2-(2,4-Dichlor-phenoxy)-heptansaeure-aethylester |