prop-2-enyl 2-prop-2-enoxycarbonyloxypropanoate
Modify Date: 2025-09-09 07:51:21
prop-2-enyl 2-prop-2-enoxycarbonyloxypropanoate structure
|
Common Name | prop-2-enyl 2-prop-2-enoxycarbonyloxypropanoate | ||
|---|---|---|---|---|
| CAS Number | 7460-72-2 | Molecular Weight | 214.21500 | |
| Density | 1.084g/cm3 | Boiling Point | 264.6ºC at 760 mmHg | |
| Molecular Formula | C10H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110ºC | |
| Name | prop-2-enyl 2-prop-2-enoxycarbonyloxypropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 264.6ºC at 760 mmHg |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.21500 |
| Flash Point | 110ºC |
| Exact Mass | 214.08400 |
| PSA | 61.83000 |
| LogP | 1.44330 |
| Index of Refraction | 1.45 |
| InChIKey | YSCKXVBYNFVUND-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)OC(C)C(=O)OCC=C |
|
~%
prop-2-enyl 2-p... CAS#:7460-72-2 |
| Literature: Rehberg; Dixon; Fisher Journal of Organic Chemistry, 1948 , vol. 13, p. 261 Journal of Organic Chemistry, 1949 , vol. 14, p. 594,600 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (1-carboallyloxy-ethyl)-allyl carbonate |
| (1-Carboallyloxy-aethyl)-allyl-carbonat |