2,4,4,6,8,8-hexachloro-N,N-dimethyl-N,N-diphenyl-1,3,5,7-tetraza-2$l^C14H16Cl6N6P4,4$l^C14H16Cl6N6P<s
Modify Date: 2025-08-25 11:55:43
2,4,4,6,8,8-hexachloro-N,N-dimethyl-N,N-diphenyl-1,3,5,7-tetraza-2$l^C14H16Cl6N6P4,4$l^C14H16Cl6N6P<s structure
|
Common Name | 2,4,4,6,8,8-hexachloro-N,N-dimethyl-N,N-diphenyl-1,3,5,7-tetraza-2$l^C14H16Cl6N6P4,4$l^C14H16Cl6N6P<s | ||
|---|---|---|---|---|
| CAS Number | 7460-32-4 | Molecular Weight | 604.93000 | |
| Density | 1.73g/cm3 | Boiling Point | 611.7ºC at 760 mmHg | |
| Molecular Formula | C14H16Cl6N6P4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.7ºC | |
| Name | 2,4,4,6,8,8-hexachloro-2-N,6-N-dimethyl-2-N,6-N-diphenyl-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene-2,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.73g/cm3 |
|---|---|
| Boiling Point | 611.7ºC at 760 mmHg |
| Molecular Formula | C14H16Cl6N6P4 |
| Molecular Weight | 604.93000 |
| Flash Point | 323.7ºC |
| Exact Mass | 601.85200 |
| PSA | 95.16000 |
| LogP | 9.23280 |
| Index of Refraction | 1.696 |
| InChIKey | BTFIOXNGGHHHCV-UHFFFAOYSA-N |
| SMILES | CN(c1ccccc1)P1(Cl)=NP(Cl)(Cl)=NP(Cl)(N(C)c2ccccc2)=NP(Cl)(Cl)=N1 |
|
~%
2,4,4,6,8,8-hex... CAS#:7460-32-4 |
| Literature: John,K. et al. Journal of the American Chemical Society, 1960 , vol. 82, p. 5616 - 5618 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,4,4,6,8,8-Hexachloro-N(2),N(6)-dimethyl-N(2),N(6)-diphenyl-1,3,5,7,2lambda(5),4lambda(5),6lambda(5),8lambda(5)-tetraazatetraphosphocine-2,6-diamine |
| Bis-methylanilino-hexachlor-tetraphosphonitril |
| 2,4,4,6,8,8-hexachloro-2-N,6-N-dimethyl-2-N,6-N-diphenyl-1,3,5,7-tetraza-2 |