2-benzofuran-1,3-dione,2,2-dimethylpropane-1,3-diol,hexane-1,6-diol
Modify Date: 2025-08-25 19:40:02
2-benzofuran-1,3-dione,2,2-dimethylpropane-1,3-diol,hexane-1,6-diol structure
|
Common Name | 2-benzofuran-1,3-dione,2,2-dimethylpropane-1,3-diol,hexane-1,6-diol | ||
|---|---|---|---|---|
| CAS Number | 74499-74-4 | Molecular Weight | 370.43700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H30O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-benzofuran-1,3-dione,2,2-dimethylpropane-1,3-diol,hexane-1,6-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H30O7 |
|---|---|
| Molecular Weight | 370.43700 |
| Exact Mass | 370.19900 |
| PSA | 124.29000 |
| LogP | 1.52580 |
| InChIKey | IKYCFUQZOIWSHR-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)CO.O=C1OC(=O)c2ccccc21.OCCCCCCO |
| 2,2-Dimethyl-1,3-propanediol,polymer with 1,6-hexanediol and 1,3-isobenzofurandione |
| 1,3-Isobenzofurandione,polymer with 2,2-dimethyl-1,3-propanediol and 1,6-hexanediol |