9-Octadecenoic acid(9Z)-, 2-methoxy-2-oxoethyl ester
Modify Date: 2025-09-11 11:29:53
9-Octadecenoic acid(9Z)-, 2-methoxy-2-oxoethyl ester structure
|
Common Name | 9-Octadecenoic acid(9Z)-, 2-methoxy-2-oxoethyl ester | ||
|---|---|---|---|---|
| CAS Number | 74275-78-8 | Molecular Weight | 354.52400 | |
| Density | 0.943g/cm3 | Boiling Point | 432.4ºC at 760 mmHg | |
| Molecular Formula | C21H38O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.5ºC | |
| Name | (2-methoxy-2-oxoethyl) (Z)-octadec-9-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.943g/cm3 |
|---|---|
| Boiling Point | 432.4ºC at 760 mmHg |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.52400 |
| Flash Point | 202.5ºC |
| Exact Mass | 354.27700 |
| PSA | 52.60000 |
| LogP | 5.74010 |
| Index of Refraction | 1.46 |
| InChIKey | JBBHHZLWNQTOCV-KHPPLWFESA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(=O)OC |
|
~%
9-Octadecenoic ... CAS#:74275-78-8 |
| Literature: Weil et al. Journal of the American Oil Chemists' Society, 1950 , vol. 27, p. 187 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Oleoyloxy-essigsaeure-methylester |
| oleoyloxy-acetic acid methyl ester |