[hydroxy-(4-methoxyphenoxy)phosphoryl]formic acid
Modify Date: 2025-08-20 15:22:37
![[hydroxy-(4-methoxyphenoxy)phosphoryl]formic acid Structure](https://image.chemsrc.com/caspic/105/74270-25-0.png)
[hydroxy-(4-methoxyphenoxy)phosphoryl]formic acid structure
|
Common Name | [hydroxy-(4-methoxyphenoxy)phosphoryl]formic acid | ||
|---|---|---|---|---|
| CAS Number | 74270-25-0 | Molecular Weight | 232.12700 | |
| Density | 1.51g/cm3 | Boiling Point | 436ºC at 760 mmHg | |
| Molecular Formula | C8H9O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.5ºC | |
| Name | [hydroxy-(4-methoxyphenoxy)phosphoryl]formic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 436ºC at 760 mmHg |
| Molecular Formula | C8H9O6P |
| Molecular Weight | 232.12700 |
| Flash Point | 217.5ºC |
| Exact Mass | 232.01400 |
| PSA | 102.87000 |
| LogP | 1.93740 |
| Index of Refraction | 1.558 |
| InChIKey | MNLGQNVSBMBKQH-UHFFFAOYSA-N |
| SMILES | COc1ccc(OP(=O)(O)C(=O)O)cc1 |
|
~%
[hydroxy-(4-met... CAS#:74270-25-0 |
| Literature: Astra Lakemedel Aktiebolag Patent: US4372894 A1, 1983 ; US 4372894 A |
|
~60%
[hydroxy-(4-met... CAS#:74270-25-0 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
|
~%
[hydroxy-(4-met... CAS#:74270-25-0 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
![phenyl [ethoxy-(4-methoxyphenoxy)phosphoryl]formate structure](https://image.chemsrc.com/caspic/292/72304-84-8.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| p-Methoxyphenyl disodium oxycarbonylphosphonate |