ethyl (2E)-2-cyano-2-tetralin-1-ylidene-acetate structure
|
Common Name | ethyl (2E)-2-cyano-2-tetralin-1-ylidene-acetate | ||
|---|---|---|---|---|
| CAS Number | 74247-18-0 | Molecular Weight | 241.28500 | |
| Density | 1.159g/cm3 | Boiling Point | 398ºC at 760 mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194ºC | |
| Name | ethyl (2E)-2-cyano-2-(3,4-dihydro-2H-naphthalen-1-ylidene)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 398ºC at 760 mmHg |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28500 |
| Flash Point | 194ºC |
| Exact Mass | 241.11000 |
| PSA | 50.09000 |
| LogP | 2.86318 |
| Index of Refraction | 1.562 |
| InChIKey | DPWJPGAEGDCSOE-BUHFOSPRSA-N |
| SMILES | CCOC(=O)C(C#N)=C1CCCc2ccccc21 |
|
~58%
ethyl (2E)-2-cy... CAS#:74247-18-0 |
| Literature: Crooks; Szyndler Journal of Medicinal Chemistry, 1980 , vol. 23, # 6 p. 679 - 682 |
| ethyl 1,2,3,4-tetrahydro-1-naphthylidene-cyanoacetate |