1,5-Pentanedisulfonicacid, 1,5-dihydroxy-, sodium salt (1:2)
Modify Date: 2025-08-26 18:39:47
1,5-Pentanedisulfonicacid, 1,5-dihydroxy-, sodium salt (1:2) structure
|
Common Name | 1,5-Pentanedisulfonicacid, 1,5-dihydroxy-, sodium salt (1:2) | ||
|---|---|---|---|---|
| CAS Number | 7420-89-5 | Molecular Weight | 287.26400 | |
| Density | 1.836g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H12NaO8S2+ | Melting Point | >300ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | Glutaraldehyde bis(sodium bisulfite) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.836g/cm3 |
|---|---|
| Melting Point | >300ºC |
| Molecular Formula | C5H12NaO8S2+ |
| Molecular Weight | 287.26400 |
| Exact Mass | 286.98700 |
| PSA | 165.96000 |
| LogP | 0.73070 |
| InChIKey | YGZZDQOCTFVBFC-UHFFFAOYSA-L |
| SMILES | O=S(=O)([O-])C(O)CCCC(O)S(=O)(=O)[O-].[Na+].[Na+] |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:111-30-8|
Effect of cross-linking on the in vitro release kinetics of doxorubicin from gelatin implants.
Int. J. Pharm. 213(1-2) , 103-16, (2001) Doxorubicin is one of the most potent anti-tumor agents used generally in the treatment of bone cancer. Like other cancer chemotharepeutics, it produces undesirable side effects such as cardiotoxicity... |
| 1,5-Dihydroxypentane-1,5-disulfonic acid disodium salt |