2-(1,1,2,2,3,3,4,4,5,5,6,6-Dodecafluorohexyl)-2,3,3-trifluorooxir ane
Modify Date: 2025-08-25 14:57:13
2-(1,1,2,2,3,3,4,4,5,5,6,6-Dodecafluorohexyl)-2,3,3-trifluorooxir ane structure
|
Common Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6-Dodecafluorohexyl)-2,3,3-trifluorooxir ane | ||
|---|---|---|---|---|
| CAS Number | 742-84-7 | Molecular Weight | 398.06900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8HF15O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6-Dodecafluorohexyl)-2,3,3-trifluorooxir ane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8HF15O |
|---|---|
| Molecular Weight | 398.06900 |
| Exact Mass | 397.97900 |
| PSA | 12.53000 |
| LogP | 4.71680 |
| InChIKey | NHBLPVMIOWIOJW-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)OC1(F)F |
| HS Code | 2910900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:63703-12-8| HS Code | 2910900090 |
|---|---|
| Summary | 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2-fluoro-5-hydrazino-pyridine |
| 1-(6-FLUOROPYRIDIN-3-YL)HYDRAZINE |
| (6H-dodecafluoro-hexyl)-trifluoro-oxirane |
| 1,2-Epoxy-8H-pentadecafluorooctan |
| (6-fluoro-pyridin-3-yl)-hydrazine |
| 1,2-Epoxy-8-hydroperfluorooctane |
| 2-fluoro-5-hydrazinylpyridine |