Molindone structure
|
Common Name | Molindone | ||
|---|---|---|---|---|
| CAS Number | 7416-34-4 | Molecular Weight | 276.37400 | |
| Density | 1.14 g/cm3 | Boiling Point | 462.9ºC at 760 mmHg | |
| Molecular Formula | C16H24N2O2 | Melting Point | 180 - 181ºC | |
| MSDS | N/A | Flash Point | 233.7ºC | |
Use of MolindoneMolindone ((±)-Molindone), an indole derivative, is a potent dopamine D2 and D5 receptor antagonist. Molindone ((±)-Molindone) can be used for the research of schizophrenia and severe mental illness[1][2]. |
| Name | 3-Ethyl-2-methyl-5-(morpholin-4-ylmethyl)-1,5,6,7-tetrahydroindol-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Molindone ((±)-Molindone), an indole derivative, is a potent dopamine D2 and D5 receptor antagonist. Molindone ((±)-Molindone) can be used for the research of schizophrenia and severe mental illness[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.14 g/cm3 |
|---|---|
| Boiling Point | 462.9ºC at 760 mmHg |
| Melting Point | 180 - 181ºC |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.37400 |
| Flash Point | 233.7ºC |
| Exact Mass | 276.18400 |
| PSA | 45.33000 |
| LogP | 1.90070 |
| Index of Refraction | 1.559 |
| InChIKey | KLPWJLBORRMFGK-UHFFFAOYSA-N |
| SMILES | CCc1c(C)[nH]c2c1C(=O)C(CN1CCOCC1)CC2 |
| Water Solubility | H2O: 19 mg/mL |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | 22 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | NM3325000 |
|
~60%
Molindone CAS#:7416-34-4 |
| Literature: Hanbauer, Martin; Nazir, Zarghun; Hildebrand, Peter; Figini, Attilia; Liang, Likan; Fumagalli, Tiziano Patent: US2014/81020 A1, 2014 ; Location in patent: Paragraph 0137; 0138 ; |
|
~%
Molindone CAS#:7416-34-4 |
| Literature: US2014/81020 A1, ; |
|
~%
Molindone CAS#:7416-34-4 |
| Literature: US2014/81020 A1, ; |
|
~%
Molindone CAS#:7416-34-4 |
| Literature: US2014/81020 A1, ; |
| 3-ethyl-2-methyl-5-morpholin-4-ylmethyl-1,5,6,7-tetrahydro-indol-4-one |
| MOLINDONE |
| molidone hydrochloride |
| EN-1733A |