4-(4-acetylphenyl)pentyl acetate
Modify Date: 2025-09-20 22:25:52
4-(4-acetylphenyl)pentyl acetate structure
|
Common Name | 4-(4-acetylphenyl)pentyl acetate | ||
|---|---|---|---|---|
| CAS Number | 74072-49-4 | Molecular Weight | 248.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-acetylphenyl)pentyl acetate |
|---|
| Molecular Formula | C15H20O3 |
|---|---|
| Molecular Weight | 248.31700 |
| Exact Mass | 248.14100 |
| PSA | 43.37000 |
| LogP | 3.33600 |
| InChIKey | MGUCMCVOWMBOPK-UHFFFAOYSA-N |
| SMILES | CC(=O)OCCCC(C)c1ccc(C(C)=O)cc1 |
|
~%
4-(4-acetylphen... CAS#:74072-49-4 |
| Literature: Din, Laily Bin; Meth-Cohn, Otto; Walshe, Nigel D. A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1991 , # 4 p. 781 - 786 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |