2-methyl-N-(2-methylpent-4-enoyl)pent-4-enehydrazide structure
|
Common Name | 2-methyl-N-(2-methylpent-4-enoyl)pent-4-enehydrazide | ||
|---|---|---|---|---|
| CAS Number | 7403-79-4 | Molecular Weight | 224.29900 | |
| Density | 0.977g/cm3 | Boiling Point | 394.8ºC at 760 mmHg | |
| Molecular Formula | C12H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.6ºC | |
| Name | 2-methyl-N'-(2-methylpent-4-enoyl)pent-4-enehydrazide |
|---|
| Density | 0.977g/cm3 |
|---|---|
| Boiling Point | 394.8ºC at 760 mmHg |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.29900 |
| Flash Point | 150.6ºC |
| Exact Mass | 224.15200 |
| PSA | 58.20000 |
| LogP | 2.34000 |
| Index of Refraction | 1.472 |
| InChIKey | WTGMHMUESMMPEM-UHFFFAOYSA-N |
| SMILES | C=CCC(C)C(=O)NNC(=O)C(C)CC=C |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |