Benzenemethanamine,N-(2,4-dinitrophenyl)- structure
|
Common Name | Benzenemethanamine,N-(2,4-dinitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 7403-38-5 | Molecular Weight | 273.24400 | |
| Density | 1.413g/cm3 | Boiling Point | 444.5ºC at 760mmHg | |
| Molecular Formula | C13H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.6ºC | |
| Name | N-benzyl-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.413g/cm3 |
|---|---|
| Boiling Point | 444.5ºC at 760mmHg |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.24400 |
| Flash Point | 222.6ºC |
| Exact Mass | 273.07500 |
| PSA | 103.67000 |
| LogP | 4.23450 |
| Index of Refraction | 1.684 |
| InChIKey | RJFWSYMASYLDLB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NCc2ccccc2)c([N+](=O)[O-])c1 |
| HS Code | 2921499090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N1-benzyl-2,4-dinitroaniline |
| N-benzyl-2,4-dinitrobenzenamine |
| (2,4-dinitrophenyl)benzylamine |
| (2.4-Dinitro-phenyl)-benzylamin |
| N-Benzyl-2,4-dinitro-anilin |
| N-benzyl-2,4-dinitro-aniline |
| N-benzyl-N-(2,4-dinitrophenyl)amine |
| (2.4-Dinito-phenyl)-benzylamin |