3-Phenanthrenol,9-nitro- structure
|
Common Name | 3-Phenanthrenol,9-nitro- | ||
|---|---|---|---|---|
| CAS Number | 7402-91-7 | Molecular Weight | 239.22600 | |
| Density | 1.424g/cm3 | Boiling Point | 479.8ºC at 760 mmHg | |
| Molecular Formula | C14H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208ºC | |
| Name | 9-Nitro-3-hydroxy-phenanthren |
|---|---|
| Synonym | More Synonyms |
| Density | 1.424g/cm3 |
|---|---|
| Boiling Point | 479.8ºC at 760 mmHg |
| Molecular Formula | C14H9NO3 |
| Molecular Weight | 239.22600 |
| Flash Point | 208ºC |
| Exact Mass | 239.05800 |
| PSA | 66.05000 |
| LogP | 4.13000 |
| Index of Refraction | 1.778 |
| InChIKey | YBIPHTBHFGUBBX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc2ccc(O)cc2c2ccccc12 |
|
~%
3-Phenanthrenol... CAS#:7402-91-7 |
| Literature: Burger; Mosettig Journal of the American Chemical Society, 1934 , vol. 56, p. 1745 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 9-n-Dodecylphenanthrene |
| 3-hydroxy-9-nitrophenanthrene |
| 9-Nitro-[3]phenanthrol |
| 9-dodecyl-phenanthrene |
| 9-n-Dodecyl-phenanthren |
| Phenanthrene,9-dodecyl |
| 9-Docecyl-phenanthren |