Ethanone,1-(4-nitrophenyl)-, 2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | Ethanone,1-(4-nitrophenyl)-, 2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 7402-79-1 | Molecular Weight | 345.26700 | |
| Density | 1.531g/cm3 | Boiling Point | 526.635ºC at 760 mmHg | |
| Molecular Formula | C14H11N5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.299ºC | |
| Name | 2,4-dinitro-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.531g/cm3 |
|---|---|
| Boiling Point | 526.635ºC at 760 mmHg |
| Molecular Formula | C14H11N5O6 |
| Molecular Weight | 345.26700 |
| Flash Point | 272.299ºC |
| Exact Mass | 345.07100 |
| PSA | 161.85000 |
| LogP | 4.88990 |
| Index of Refraction | 1.676 |
| InChIKey | QLKRMOOBIISESL-DHDCSXOGSA-N |
| SMILES | CC(=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1 |
|
~0%
Ethanone,1-(4-n... CAS#:7402-79-1 |
| Literature: Teo, Peili; Wickens, Zachary K.; Dong, Guangbin; Grubbs, Robert H. Organic Letters, 2012 , vol. 14, # 13 p. 3237 - 3239 |
|
~72%
Ethanone,1-(4-n... CAS#:7402-79-1 |
| Literature: Rector, Douglas L.; Folz, S. D.; Conklin, R. D.; Nowakowski, L. H.; Kaugars, Girts Journal of Medicinal Chemistry, 1981 , vol. 24, # 5 p. 532 - 538 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4'-nitroacetophenone thiosemicarbazone |
| p-acetylnitrobenzene |
| p-nitroacetophenone thiosemicarbazone |
| p-Nitroacetophenon-2,4-dinitro-phenylhydrazon |
| 4'-nitroacetophenone 2,4-dinitrophenylhydrazone |
| 4-Nitro-acetophenon-<2.4-dinitro-phenylhydrazon> |