4-(4-bromophenyl)sulfonylphenol
Modify Date: 2025-08-25 14:41:55
4-(4-bromophenyl)sulfonylphenol structure
|
Common Name | 4-(4-bromophenyl)sulfonylphenol | ||
|---|---|---|---|---|
| CAS Number | 7402-66-6 | Molecular Weight | 313.16700 | |
| Density | 1.627g/cm3 | Boiling Point | 477.4ºC at 760 mmHg | |
| Molecular Formula | C12H9BrO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.5ºC | |
| Name | 4-(4-bromophenyl)sulfonylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.627g/cm3 |
|---|---|
| Boiling Point | 477.4ºC at 760 mmHg |
| Molecular Formula | C12H9BrO3S |
| Molecular Weight | 313.16700 |
| Flash Point | 242.5ºC |
| Exact Mass | 311.94600 |
| PSA | 62.75000 |
| LogP | 4.06830 |
| Index of Refraction | 1.642 |
| InChIKey | QWJWBOCALGDPED-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccc(O)cc1)c1ccc(Br)cc1 |
|
~%
4-(4-bromopheny... CAS#:7402-66-6 |
| Literature: Szmant; Suld Journal of the American Chemical Society, 1956 , vol. 78, p. 3400,3401 |
|
~%
4-(4-bromopheny... CAS#:7402-66-6 |
| Literature: Szmant; Suld Journal of the American Chemical Society, 1956 , vol. 78, p. 3400,3401 |
|
~%
4-(4-bromopheny... CAS#:7402-66-6 |
| Literature: Szmant; Suld Journal of the American Chemical Society, 1956 , vol. 78, p. 3400,3401 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-(4-bromo-benzenesulfonyl)-phenol |
| 4-(4-Brom-benzolsulfonyl)-phenol |