Fumaric acid,(2,4-dichlorophenoxy)- (8CI) structure
|
Common Name | Fumaric acid,(2,4-dichlorophenoxy)- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 7401-79-8 | Molecular Weight | 277.05800 | |
| Density | 1.634g/cm3 | Boiling Point | 459.7ºC at 760mmHg | |
| Molecular Formula | C10H6Cl2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.8ºC | |
| Name | (E)-2-(2,4-dichlorophenoxy)but-2-enedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.634g/cm3 |
|---|---|
| Boiling Point | 459.7ºC at 760mmHg |
| Molecular Formula | C10H6Cl2O5 |
| Molecular Weight | 277.05800 |
| Flash Point | 231.8ºC |
| Exact Mass | 275.95900 |
| PSA | 83.83000 |
| LogP | 2.42530 |
| Index of Refraction | 1.621 |
| InChIKey | WZGPQIYEVPPBAX-XBXARRHUSA-N |
| SMILES | O=C(O)C=C(Oc1ccc(Cl)cc1Cl)C(=O)O |
|
~%
Fumaric acid,(2... CAS#:7401-79-8 |
| Literature: Newman; Fones; Renoll Journal of the American Chemical Society, 1947 , vol. 69, p. 718,721 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-dibutylamino-propane-1,2-diol |
| 3-Dibutylamino-propan-1,2-diol |
| 3-Dibutylamino-1.2-dihydroxy-propan |
| N-Di-n-butyl-2,3-dihydroxypropylamin |