4,4-dimethyl-1,2-di(4-morpholinyl)-1-phenyl-3-pentanone
Modify Date: 2025-08-24 20:01:18
4,4-dimethyl-1,2-di(4-morpholinyl)-1-phenyl-3-pentanone structure
|
Common Name | 4,4-dimethyl-1,2-di(4-morpholinyl)-1-phenyl-3-pentanone | ||
|---|---|---|---|---|
| CAS Number | 7400-52-4 | Molecular Weight | 360.49000 | |
| Density | 1.104g/cm3 | Boiling Point | 458.3ºC at 760 mmHg | |
| Molecular Formula | C21H32N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231ºC | |
| Name | 4,4-dimethyl-1,2-dimorpholin-4-yl-1-phenylpentan-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.104g/cm3 |
|---|---|
| Boiling Point | 458.3ºC at 760 mmHg |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.49000 |
| Flash Point | 231ºC |
| Exact Mass | 360.24100 |
| PSA | 42.01000 |
| LogP | 2.25170 |
| Index of Refraction | 1.538 |
| InChIKey | QZUIQRACPQHJJM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C(C(c1ccccc1)N1CCOCC1)N1CCOCC1 |
|
~%
4,4-dimethyl-1,... CAS#:7400-52-4 |
| Literature: Lutz et al. Journal of Organic Chemistry, 1949 , vol. 14, p. 982,994 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4-dimethyl-1,2-dimorpholino-1-phenyl-pentan-3-one |
| HMS3078B07 |