Benzeneacetic acid, a-amino-3-bromo-a-methyl-
Modify Date: 2025-11-25 13:32:48
Benzeneacetic acid, a-amino-3-bromo-a-methyl- structure
|
Common Name | Benzeneacetic acid, a-amino-3-bromo-a-methyl- | ||
|---|---|---|---|---|
| CAS Number | 7399-36-2 | Molecular Weight | 244.08500 | |
| Density | 1.583g/cm3 | Boiling Point | 337.6ºC at 760mmHg | |
| Molecular Formula | C9H10BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158ºC | |
| Name | 2-amino-2-(3-bromophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.583g/cm3 |
|---|---|
| Boiling Point | 337.6ºC at 760mmHg |
| Molecular Formula | C9H10BrNO2 |
| Molecular Weight | 244.08500 |
| Flash Point | 158ºC |
| Exact Mass | 242.98900 |
| PSA | 63.32000 |
| LogP | 2.40790 |
| Index of Refraction | 1.601 |
| InChIKey | VLAAMUVAJIERNC-UHFFFAOYSA-N |
| SMILES | CC(N)(C(=O)O)c1cccc(Br)c1 |
| HS Code | 2922499990 |
|---|
|
~%
Benzeneacetic a... CAS#:7399-36-2 |
| Literature: JANSSEN PHARMACEUTICA NV; TRABANCO-SUAREZ, Andres, Avelino; TRESADERN, Gary, John; MACDONALD, Gregor, James; VEGA RAMIRO, Juan, Antonio Patent: WO2011/154374 A1, 2011 ; WO 2011/154374 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| rac-2-amino-2-(3-bromophenyl)propionic acid |
| 2-amino-2-(3-bromo-phenyl)-propionic acid |