1-(2,4-dimethylphenyl)-2,2-dimethylpropan-1-one structure
|
Common Name | 1-(2,4-dimethylphenyl)-2,2-dimethylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 7396-99-8 | Molecular Weight | 190.28100 | |
| Density | 0.936g/cm3 | Boiling Point | 273.6ºC at 760 mmHg | |
| Molecular Formula | C13H18O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.8ºC | |
| Name | 1-(2,4-dimethylphenyl)-2,2-dimethylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.936g/cm3 |
|---|---|
| Boiling Point | 273.6ºC at 760 mmHg |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28100 |
| Flash Point | 109.8ºC |
| Exact Mass | 190.13600 |
| PSA | 17.07000 |
| LogP | 3.53220 |
| Index of Refraction | 1.5 |
| InChIKey | MVLBAIKXOSEZDJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)C(C)(C)C)c(C)c1 |
| HS Code | 2914399090 |
|---|
|
~%
1-(2,4-dimethyl... CAS#:7396-99-8 |
| Literature: Nightingale; Shanholtzer Journal of Organic Chemistry, 1942 , vol. 7, p. 6,10 |
|
~%
1-(2,4-dimethyl... CAS#:7396-99-8 |
| Literature: Nightingale; Shanholtzer Journal of Organic Chemistry, 1942 , vol. 7, p. 6,10 |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1-(2,4-dimethyl-phenyl)-2,2-dimethyl-propan-1-one |
| 2',2,2,4'-TETRAMETHYLPROPIOPHENONE |
| tert.-Butyl(2,4-dimethylphenyl)keton |
| 2,4-Dimethylpivalophenon |