1-[2-(2-chloroethylsulfinyl)ethyl]-3-cyclohexyl-1-nitroso-urea structure
|
Common Name | 1-[2-(2-chloroethylsulfinyl)ethyl]-3-cyclohexyl-1-nitroso-urea | ||
|---|---|---|---|---|
| CAS Number | 73944-54-4 | Molecular Weight | 309.81300 | |
| Density | 1.44g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H20ClN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-(2-chloroethylsulfinyl)ethyl]-3-cyclohexyl-1-nitrosourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Molecular Formula | C11H20ClN3O3S |
| Molecular Weight | 309.81300 |
| Exact Mass | 309.09100 |
| PSA | 98.05000 |
| LogP | 3.25620 |
| Index of Refraction | 1.625 |
| InChIKey | NAWRBSFXUOCDCQ-UHFFFAOYSA-N |
| SMILES | O=NN(CCS(=O)CCCl)C(=O)NC1CCCCC1 |
|
~%
1-[2-(2-chloroe... CAS#:73944-54-4 |
| Literature: Lown, J. William; Joshua, Alummoottil V.; McLaughlin, Larry W. Journal of Medicinal Chemistry, 1980 , vol. 23, # 7 p. 798 - 805 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 1-chloro-2-trimethylsilanyloxy-ethane |