4-(2-pyridylazo)naphthol
Modify Date: 2024-08-27 13:49:53
4-(2-pyridylazo)naphthol structure
|
Common Name | 4-(2-pyridylazo)naphthol | ||
|---|---|---|---|---|
| CAS Number | 7385-98-0 | Molecular Weight | 249.26700 | |
| Density | 1.247g/cm3 | Boiling Point | 429.996ºC at 760 mmHg | |
| Molecular Formula | C15H11N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.854ºC | |
| Name | (4E)-4-(pyridin-2-ylhydrazinylidene)naphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 429.996ºC at 760 mmHg |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.26700 |
| Flash Point | 213.854ºC |
| Exact Mass | 249.09000 |
| PSA | 54.35000 |
| LogP | 2.72330 |
| Index of Refraction | 1.662 |
| InChIKey | PHXBEBHRRKEUOJ-UHFFFAOYSA-N |
| SMILES | Oc1ccc(N=Nc2ccccn2)c2ccccc12 |
| HS Code | 2933399090 |
|---|
|
~%
4-(2-pyridylazo... CAS#:7385-98-0 |
| Literature: Tschitschibabin Zhurnal Russkago Fiziko-Khimicheskago Obshchestva, 1920 , vol. 50, p. 516,518 Chem. Zentralbl., 1923 , vol. 94, # III p. 1022 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Naphthalenol,4-(2-pyridinylazo) |
| 4-(2-Pyridylazo)-1-naphthol |
| 4-pyridin-2-ylazo-naphthalen-1-ol |
| 1-(2-pyridylazo)-4-hydroxynaphthalene |
| 4-(PYRIDIN-2-YLAZO)NAPHTHOL |
| 4-(2-Pyridylazo)naphthol |