propylene di(octanoate) structure
|
Common Name | propylene di(octanoate) | ||
|---|---|---|---|---|
| CAS Number | 7384-98-7 | Molecular Weight | 328.48700 | |
| Density | 0.939g/cm3 | Boiling Point | 397.7ºC at 760 mmHg | |
| Molecular Formula | C19H36O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.3ºC | |
| Name | 1,2-Propanediyl dioctanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.939g/cm3 |
|---|---|
| Boiling Point | 397.7ºC at 760 mmHg |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.48700 |
| Flash Point | 184.3ºC |
| Exact Mass | 328.26100 |
| PSA | 52.60000 |
| LogP | 5.18230 |
| Index of Refraction | 1.448 |
| InChIKey | OVYMWJFNQQOJBU-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCC(C)OC(=O)CCCCCCC |
| HS Code | 2915900090 |
|---|
|
~50%
propylene di(oc... CAS#:7384-98-7 |
| Literature: Briggs, Josie C.; Haines, Alan H.; Taylor, Richard J. K.; Dawson, Alan P.; Gibson, I.; et al. Carbohydrate Research, 1992 , vol. 234, p. 23 - 36 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 1,2-bis-nitrooxy-propane |
| Isopropylene nitrate |
| 1,2-dinitrooxy-propane |
| Propane-1,2-diyl dinitrate |
| propylene di(octanoate) |
| 1,2-Propylene glycol dinitrate |
| Propylene dinitrate |
| Propylene nitrate |
| nitric acid propanediyl ester |
| propylene glycol dinitrate |
| propyleneglycol dicaprylate |
| 1,2-propanediol dioctanoate |
| propane-1,2-diol dinitrate |
| Salpetersaeure-propandiylester |
| PGDN |
| Propylene glycol 1,2-dinitrate |
| 1,2-propyl dinitrate |
| propylene glycol dioctanoate |
| 1,2-Propanediol,dinitrate |