4-Nitro-1,2-dihydro-3H-indazol-3-one
Modify Date: 2025-08-25 17:08:08
4-Nitro-1,2-dihydro-3H-indazol-3-one structure
|
Common Name | 4-Nitro-1,2-dihydro-3H-indazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 7384-16-9 | Molecular Weight | 179.133 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 477.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C7H5N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.5±23.2 °C | |
| Name | 4-nitro-1,2-dihydroindazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 477.4±25.0 °C at 760 mmHg |
| Molecular Formula | C7H5N3O3 |
| Molecular Weight | 179.133 |
| Flash Point | 242.5±23.2 °C |
| Exact Mass | 179.033096 |
| PSA | 94.73000 |
| LogP | 1.48 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.800 |
| InChIKey | JIYHKUVJNVDYQH-UHFFFAOYSA-N |
| SMILES | O=c1[nH][nH]c2cccc([N+](=O)[O-])c12 |
| HS Code | 2933990090 |
|---|
|
~35%
4-Nitro-1,2-dih... CAS#:7384-16-9 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GMBH Patent: WO2006/21544 A1, 2006 ; Location in patent: Page/Page column 32 ; WO 2006/021544 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Nitro-1,2-dihydro-3H-indazol-3-one |
| 3-HYDROXY-4-NITRO-1H-INDAZOLE |
| 3H-Indazol-3-one, 1,2-dihydro-4-nitro- |
| 4-nitro-1,2-dihydro-indazol-3-one |
| 4-Nitro-1H-indazol-3-ol |
| 5-Nitro-3-indazolinon |